C11H11F9O2 — CID 157152268
5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one (PubChem CID 157152268) has the molecular formula C11H11F9O2 and a molecular weight of 346.19 g/mol. Its IUPAC name is 5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one.
| Compound Name | 5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one |
|---|---|
| PubChem CID | 157152268 |
| Molecular Formula | C11H11F9O2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 5-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)pent-1-en-3-one |
| SMILES | C=CC(=O)CCOCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H11F9O2/c1-2-7(21)3-5-22-6-4-8(12,13)9(14,15)10(16,17)11(18,19)20/h2H,1,3-6H2 |
| InChIKey | ALJWIXOHMPBWDQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|