C14H16ClN3O — CID 157154285
N-(7-chloro-3,4,5,6-tetramethyl-1,8-naphthyridin-2-yl)acetamide (PubChem CID 157154285) has the molecular formula C14H16ClN3O and a molecular weight of 277.75 g/mol. Its IUPAC name is N-(7-chloro-3,4,5,6-tetramethyl-1,8-naphthyridin-2-yl)acetamide.
| Compound Name | N-(7-chloro-3,4,5,6-tetramethyl-1,8-naphthyridin-2-yl)acetamide |
|---|---|
| PubChem CID | 157154285 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(7-chloro-3,4,5,6-tetramethyl-1,8-naphthyridin-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2nc(Cl)c(C)c(C)c2c(C)c1C |
| InChI | InChI=1S/C14H16ClN3O/c1-6-8(3)12(15)17-14-11(6)7(2)9(4)13(18-14)16-10(5)19/h1-5H3,(H,16,17,18,19) |
| InChIKey | ZAMCZIXWUNGWSD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|