C23H45NO — CID 157158322
1-tert-butyl-3-methylcyclohexane;1-(3-tert-butyl-5-methylpiperidin-1-yl)ethanone (PubChem CID 157158322) has the molecular formula C23H45NO and a molecular weight of 351.62 g/mol. Its IUPAC name is 1-tert-butyl-3-methylcyclohexane;1-(3-tert-butyl-5-methylpiperidin-1-yl)ethanone.
| Compound Name | 1-tert-butyl-3-methylcyclohexane;1-(3-tert-butyl-5-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 157158322 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | 1-tert-butyl-3-methylcyclohexane;1-(3-tert-butyl-5-methylpiperidin-1-yl)ethanone |
| SMILES | CC(=O)N1CC(C)CC(C(C)(C)C)C1.CC1CCCC(C(C)(C)C)C1 |
| InChI | InChI=1S/C12H23NO.C11H22/c1-9-6-11(12(3,4)5)8-13(7-9)10(2)14;1-9-6-5-7-10(8-9)11(2,3)4/h9,11H,6-8H2,1-5H3;9-10H,5-8H2,1-4H3 |
| InChIKey | AMBOSBURVRCARJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |