About 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium
2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium (PubChem CID 157160593) has the molecular formula C30H31F2O5S2+
and a molecular weight of 573.70 g/mol. Its IUPAC name is 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| PubChem CID | 157160593 |
| Molecular Formula | C30H31F2O5S2+ |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium |
| SMILES | O=C(OC1C2CC3CC(C2)CC1C3)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C12H16F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-11(14)20(16,17)19-12(15)18-10-8-2-6-1-7(4-8)5-9(10)3-6/h1-15H;6-11H,1-5H2/q+1; |
| InChIKey | AMICEFZZIQUNPS-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The IUPAC name of 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium (CID 157160593) is 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium.
What is the SMILES notation for 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The canonical SMILES for 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium is O=C(OC1C2CC3CC(C2)CC1C3)OS(=O)(=O)C(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
The InChIKey is AMICEFZZIQUNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C12H16F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;13-11(14)20(16,17)19-12(15)18-10-8-2-6-1-7(4-8)5-9(10)3-6/h1-15H;6-11H,1-5H2/q+1;.
What are the key properties of 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium?
2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium has a molecular weight of 573.70 g/mol, XLogP of 7.30, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-adamantyloxycarbonyl difluoromethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 157160593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).