About acetic acid;tetramethyl silicate
acetic acid;tetramethyl silicate (PubChem CID 157163624) has the molecular formula C6H16O6Si
and a molecular weight of 212.27 g/mol. Its IUPAC name is acetic acid;tetramethyl silicate.
Molecular Properties
| Compound Name | acetic acid;tetramethyl silicate |
| PubChem CID | 157163624 |
| Molecular Formula | C6H16O6Si |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | acetic acid;tetramethyl silicate |
| SMILES | CC(=O)O.CO[Si](OC)(OC)OC |
| InChI | InChI=1S/C4H12O4Si.C2H4O2/c1-5-9(6-2,7-3)8-4;1-2(3)4/h1-4H3;1H3,(H,3,4) |
| InChIKey | AMQUBJOSVWQCMM-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;tetramethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;tetramethyl silicate?
The IUPAC name of acetic acid;tetramethyl silicate (CID 157163624) is acetic acid;tetramethyl silicate.
What is the SMILES notation for acetic acid;tetramethyl silicate?
The canonical SMILES for acetic acid;tetramethyl silicate is CC(=O)O.CO[Si](OC)(OC)OC.
What is the InChIKey of acetic acid;tetramethyl silicate?
The InChIKey is AMQUBJOSVWQCMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O4Si.C2H4O2/c1-5-9(6-2,7-3)8-4;1-2(3)4/h1-4H3;1H3,(H,3,4).
What are the key properties of acetic acid;tetramethyl silicate?
acetic acid;tetramethyl silicate has a molecular weight of 212.27 g/mol, XLogP of 0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tetramethyl silicate is sourced from PubChem (CID 157163624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).