About 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine
5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine (PubChem CID 157167829) has the molecular formula C10H10I2N6O2
and a molecular weight of 500.04 g/mol. Its IUPAC name is 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine.
Molecular Properties
| Compound Name | 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine |
| PubChem CID | 157167829 |
| Molecular Formula | C10H10I2N6O2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.90 |
| IUPAC Name | 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine |
| SMILES | Nc1cc(I)cnc1N.Nc1ncc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4IN3O2.C5H6IN3/c6-3-1-4(9(10)11)5(7)8-2-3;6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,7,8);1-2H,7H2,(H2,8,9) |
| InChIKey | ANCWAGCATXOPJK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine?
The IUPAC name of 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine (CID 157167829) is 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine.
What is the SMILES notation for 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine?
The canonical SMILES for 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine is Nc1cc(I)cnc1N.Nc1ncc(I)cc1[N+](=O)[O-].
What is the InChIKey of 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine?
The InChIKey is ANCWAGCATXOPJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4IN3O2.C5H6IN3/c6-3-1-4(9(10)11)5(7)8-2-3;6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,7,8);1-2H,7H2,(H2,8,9).
What are the key properties of 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine?
5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine has a molecular weight of 500.04 g/mol, XLogP of 2.03, 1 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine is sourced from PubChem (CID 157167829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).