C10H10I2N6O2 — CID 157167829
5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine (PubChem CID 157167829) has the molecular formula C10H10I2N6O2 and a molecular weight of 500.04 g/mol. Its IUPAC name is 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine.
| Compound Name | 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine |
|---|---|
| PubChem CID | 157167829 |
| Molecular Formula | C10H10I2N6O2 |
| Molecular Weight | 500.04 g/mol |
| Exact Mass | 499.90 |
| IUPAC Name | 5-iodo-3-nitropyridin-2-amine;5-iodopyridine-2,3-diamine |
| SMILES | Nc1cc(I)cnc1N.Nc1ncc(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C5H4IN3O2.C5H6IN3/c6-3-1-4(9(10)11)5(7)8-2-3;6-3-1-4(7)5(8)9-2-3/h1-2H,(H2,7,8);1-2H,7H2,(H2,8,9) |
| InChIKey | ANCWAGCATXOPJK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 146.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.04 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|