C10H16BN5O3 — CID 140732466
[4-(6-amino-5-nitro-3-pyridinyl)piperazin-1-yl]-methylborinic acid (PubChem CID 140732466) has the molecular formula C10H16BN5O3 and a molecular weight of 265.08 g/mol. Its IUPAC name is [4-(6-amino-5-nitro-3-pyridinyl)piperazin-1-yl]-methylborinic acid.
| Compound Name | [4-(6-amino-5-nitro-3-pyridinyl)piperazin-1-yl]-methylborinic acid |
|---|---|
| PubChem CID | 140732466 |
| Molecular Formula | C10H16BN5O3 |
| Molecular Weight | 265.08 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | [4-(6-amino-5-nitro-3-pyridinyl)piperazin-1-yl]-methylborinic acid |
| SMILES | CB(O)N1CCN(c2cnc(N)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C10H16BN5O3/c1-11(17)15-4-2-14(3-5-15)8-6-9(16(18)19)10(12)13-7-8/h6-7,17H,2-5H2,1H3,(H2,12,13) |
| InChIKey | SOFCGTRCJHNKPS-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 108.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.08 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|