About CID 157169079
CID 157169079 (PubChem CID 157169079) has the molecular formula C12H17NW2
and a molecular weight of 542.96 g/mol.
Molecular Properties
| Compound Name | CID 157169079 |
| PubChem CID | 157169079 |
| Molecular Formula | C12H17NW2 |
| Molecular Weight | 542.96 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | — |
| SMILES | C=CC=CCN(CC)CC(=[W])C=CC=[W] |
| InChI | InChI=1S/C12H17N.2W/c1-4-7-9-11-13(6-3)12-10-8-5-2;;/h1,4-5,7-8,10H,2,6,11-12H2,3H3;; |
| InChIKey | PEHPBARSKXQTBA-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 542.96 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 157169079 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 157169079?
The IUPAC name of CID 157169079 (CID 157169079) is not available.
What is the SMILES notation for CID 157169079?
The canonical SMILES for CID 157169079 is C=CC=CCN(CC)CC(=[W])C=CC=[W].
What is the InChIKey of CID 157169079?
The InChIKey is PEHPBARSKXQTBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N.2W/c1-4-7-9-11-13(6-3)12-10-8-5-2;;/h1,4-5,7-8,10H,2,6,11-12H2,3H3;;.
What are the key properties of CID 157169079?
CID 157169079 has a molecular weight of 542.96 g/mol, XLogP of 1.67, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 157169079 is sourced from PubChem (CID 157169079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).