C13H21N5 — CID 157171988
4-N-cyclopenta-1,4-dien-1-yl-4-N,6-N,6-N,2,5-pentamethyl-2H-1,3,5-triazine-4,6-diamine (PubChem CID 157171988) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is 4-N-cyclopenta-1,4-dien-1-yl-4-N,6-N,6-N,2,5-pentamethyl-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 4-N-cyclopenta-1,4-dien-1-yl-4-N,6-N,6-N,2,5-pentamethyl-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 157171988 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | 4-N-cyclopenta-1,4-dien-1-yl-4-N,6-N,6-N,2,5-pentamethyl-2H-1,3,5-triazine-4,6-diamine |
| SMILES | CC1N=C(N(C)C)N(C)C(N(C)C2=CCC=C2)=N1 |
| InChI | InChI=1S/C13H21N5/c1-10-14-12(16(2)3)18(5)13(15-10)17(4)11-8-6-7-9-11/h6,8-10H,7H2,1-5H3 |
| InChIKey | FISVJXTZALAKII-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |