C21H16F10O9S2 — CID 157173735
1,1,3,3,3-pentafluoro-2-(furan-2-ylmethoxy)propane-1-sulfonic acid;1,1,3,3,3-pentafluoro-2-naphthalen-2-yloxypropane-1-sulfonic acid (PubChem CID 157173735) has the molecular formula C21H16F10O9S2 and a molecular weight of 666.46 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(furan-2-ylmethoxy)propane-1-sulfonic acid;1,1,3,3,3-pentafluoro-2-naphthalen-2-yloxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(furan-2-ylmethoxy)propane-1-sulfonic acid;1,1,3,3,3-pentafluoro-2-naphthalen-2-yloxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 157173735 |
| Molecular Formula | C21H16F10O9S2 |
| Molecular Weight | 666.46 g/mol |
| Exact Mass | 666.01 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(furan-2-ylmethoxy)propane-1-sulfonic acid;1,1,3,3,3-pentafluoro-2-naphthalen-2-yloxypropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(OCc1ccco1)C(F)(F)F.O=S(=O)(O)C(F)(F)C(Oc1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C13H9F5O4S.C8H7F5O5S/c14-12(15,16)11(13(17,18)23(19,20)21)22-10-6-5-8-3-1-2-4-9(8)7-10;9-7(10,11)6(8(12,13)19(14,15)16)18-4-5-2-1-3-17-5/h1-7,11H,(H,19,20,21);1-3,6H,4H2,(H,14,15,16) |
| InChIKey | ANTORYCRQWXJFH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.46 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|