C22H12F10O10S2 — CID 90764571
[1,1,1,3,3-pentafluoro-3-[1,1,3,3,3-pentafluoro-2-(naphthalene-1-carbonyloxy)propyl]sulfonyloxysulfonylpropan-2-yl] furan-2-carboxylate (PubChem CID 90764571) has the molecular formula C22H12F10O10S2 and a molecular weight of 690.44 g/mol. Its IUPAC name is [1,1,1,3,3-pentafluoro-3-[1,1,3,3,3-pentafluoro-2-(naphthalene-1-carbonyloxy)propyl]sulfonyloxysulfonylpropan-2-yl] furan-2-carboxylate.
| Compound Name | [1,1,1,3,3-pentafluoro-3-[1,1,3,3,3-pentafluoro-2-(naphthalene-1-carbonyloxy)propyl]sulfonyloxysulfonylpropan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 90764571 |
| Molecular Formula | C22H12F10O10S2 |
| Molecular Weight | 690.44 g/mol |
| Exact Mass | 689.97 |
| IUPAC Name | [1,1,1,3,3-pentafluoro-3-[1,1,3,3,3-pentafluoro-2-(naphthalene-1-carbonyloxy)propyl]sulfonyloxysulfonylpropan-2-yl] furan-2-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)C(OC(=O)c1cccc2ccccc12)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C22H12F10O10S2/c23-19(24,25)17(40-15(33)13-8-3-6-11-5-1-2-7-12(11)13)21(29,30)43(35,36)42-44(37,38)22(31,32)18(20(26,27)28)41-16(34)14-9-4-10-39-14/h1-10,17-18H |
| InChIKey | WOPYXBVXPQRGPT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 143.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |