C22H18F4O11S2-2 — CID 123343119
1,1-difluoro-2-(furan-2-carbonyloxy)propane-1-sulfonate;1,1-difluoro-2-(naphthalene-2-carbonyloxy)propane-1-sulfonate (PubChem CID 123343119) has the molecular formula C22H18F4O11S2-2 and a molecular weight of 598.50 g/mol. Its IUPAC name is 1,1-difluoro-2-(furan-2-carbonyloxy)propane-1-sulfonate;1,1-difluoro-2-(naphthalene-2-carbonyloxy)propane-1-sulfonate.
| Compound Name | 1,1-difluoro-2-(furan-2-carbonyloxy)propane-1-sulfonate;1,1-difluoro-2-(naphthalene-2-carbonyloxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 123343119 |
| Molecular Formula | C22H18F4O11S2-2 |
| Molecular Weight | 598.50 g/mol |
| Exact Mass | 598.02 |
| IUPAC Name | 1,1-difluoro-2-(furan-2-carbonyloxy)propane-1-sulfonate;1,1-difluoro-2-(naphthalene-2-carbonyloxy)propane-1-sulfonate |
| SMILES | CC(OC(=O)c1ccc2ccccc2c1)C(F)(F)S(=O)(=O)[O-].CC(OC(=O)c1ccco1)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C14H12F2O5S.C8H8F2O6S/c1-9(14(15,16)22(18,19)20)21-13(17)12-7-6-10-4-2-3-5-11(10)8-12;1-5(8(9,10)17(12,13)14)16-7(11)6-3-2-4-15-6/h2-9H,1H3,(H,18,19,20);2-5H,1H3,(H,12,13,14)/p-2 |
| InChIKey | ZMAPXVKJJGRSJY-UHFFFAOYSA-L |
| XLogP | 3.49 |
| TPSA | 180.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|