benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate

C24H20O3 — CID 71485308

IUPACbenzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate
SMILESCCc1c(-c2ccc3ccccc3c2)coc1C(=O)OCc1ccccc1
InChIInChI=1S/C24H20O3/c1-2-21-22(20-13-12-18-10-6-7-11-19(18)14-20)16-26-23(21)24(25)27-15-17-8-4-3-5-9-17/h3-14,16H,2,15H2,1H3
InChIKeyWQXWQMRUWCWBTN-UHFFFAOYSA-N
MW356.42 g/mol
LogP6.02
Rot. Bonds5

About benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate

benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate (PubChem CID 71485308) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate.

Molecular Properties

Compound Namebenzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate
PubChem CID71485308
Molecular FormulaC24H20O3
Molecular Weight356.42 g/mol
Exact Mass356.14
IUPAC Namebenzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate
SMILESCCc1c(-c2ccc3ccccc3c2)coc1C(=O)OCc1ccccc1
InChIInChI=1S/C24H20O3/c1-2-21-22(20-13-12-18-10-6-7-11-19(18)14-20)16-26-23(21)24(25)27-15-17-8-4-3-5-9-17/h3-14,16H,2,15H2,1H3
InChIKeyWQXWQMRUWCWBTN-UHFFFAOYSA-N
XLogP6.02
TPSA39.44 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms27
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500356.42
LogP ≤ 56.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate?
The IUPAC name of benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate (CID 71485308) is benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate.
What is the SMILES notation for benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate?
The canonical SMILES for benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate is CCc1c(-c2ccc3ccccc3c2)coc1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate?
The InChIKey is WQXWQMRUWCWBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O3/c1-2-21-22(20-13-12-18-10-6-7-11-19(18)14-20)16-26-23(21)24(25)27-15-17-8-4-3-5-9-17/h3-14,16H,2,15H2,1H3.
What are the key properties of benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate?
benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate has a molecular weight of 356.42 g/mol, XLogP of 6.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-ethyl-4-naphthalen-2-ylfuran-2-carboxylate is sourced from PubChem (CID 71485308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).