C20H24F6O11S2-2 — CID 158883725
4-(cyclohexanecarbonyloxy)-1,1,1-trifluorobutane-2-sulfonate;1,1,2-trifluoro-4-(furan-2-carbonyloxy)butane-1-sulfonate (PubChem CID 158883725) has the molecular formula C20H24F6O11S2-2 and a molecular weight of 618.52 g/mol. Its IUPAC name is 4-(cyclohexanecarbonyloxy)-1,1,1-trifluorobutane-2-sulfonate;1,1,2-trifluoro-4-(furan-2-carbonyloxy)butane-1-sulfonate.
| Compound Name | 4-(cyclohexanecarbonyloxy)-1,1,1-trifluorobutane-2-sulfonate;1,1,2-trifluoro-4-(furan-2-carbonyloxy)butane-1-sulfonate |
|---|---|
| PubChem CID | 158883725 |
| Molecular Formula | C20H24F6O11S2-2 |
| Molecular Weight | 618.52 g/mol |
| Exact Mass | 618.07 |
| IUPAC Name | 4-(cyclohexanecarbonyloxy)-1,1,1-trifluorobutane-2-sulfonate;1,1,2-trifluoro-4-(furan-2-carbonyloxy)butane-1-sulfonate |
| SMILES | O=C(OCCC(C(F)(F)F)S(=O)(=O)[O-])C1CCCCC1.O=C(OCCC(F)C(F)(F)S(=O)(=O)[O-])c1ccco1 |
| InChI | InChI=1S/C11H17F3O5S.C9H9F3O6S/c12-11(13,14)9(20(16,17)18)6-7-19-10(15)8-4-2-1-3-5-8;10-7(9(11,12)19(14,15)16)3-5-18-8(13)6-2-1-4-17-6/h8-9H,1-7H2,(H,16,17,18);1-2,4,7H,3,5H2,(H,14,15,16)/p-2 |
| InChIKey | JDISTZOVTUMDSN-UHFFFAOYSA-L |
| XLogP | 3.28 |
| TPSA | 180.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|