C37H46F4O4S2 — CID 157176666
1-(4-butoxynaphthalen-1-yl)-4-thioniatricyclo[5.2.1.02,6]decane;1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 157176666) has the molecular formula C37H46F4O4S2 and a molecular weight of 694.90 g/mol. Its IUPAC name is 1-(4-butoxynaphthalen-1-yl)-4-thioniatricyclo[5.2.1.02,6]decane;1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | 1-(4-butoxynaphthalen-1-yl)-4-thioniatricyclo[5.2.1.02,6]decane;1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 157176666 |
| Molecular Formula | C37H46F4O4S2 |
| Molecular Weight | 694.90 g/mol |
| Exact Mass | 694.28 |
| IUPAC Name | 1-(4-butoxynaphthalen-1-yl)-4-thioniatricyclo[5.2.1.02,6]decane;1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | CCCCOc1ccc(C23CCC(C2)C2C[SH+]CC23)c2ccccc12.O=S(=O)([O-])C(F)(F)C(F)(F)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C23H28OS.C14H18F4O3S/c1-2-3-12-24-22-9-8-20(17-6-4-5-7-18(17)22)23-11-10-16(13-23)19-14-25-15-21(19)23;15-13(16,14(17,18)22(19,20)21)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h4-9,16,19,21H,2-3,10-15H2,1H3;6-12H,1-5H2,(H,19,20,21) |
| InChIKey | AOBZJLFWQSHAPS-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.90 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|