C32H42F2O4S2 — CID 140519472
[1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1-difluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 140519472) has the molecular formula C32H42F2O4S2 and a molecular weight of 592.81 g/mol. Its IUPAC name is [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1-difluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1-difluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 140519472 |
| Molecular Formula | C32H42F2O4S2 |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | [1-(4-butoxynaphthalen-1-yl)thiolan-1-yl] 1,1-difluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | CCCCOc1ccc(S2(OS(=O)(=O)C(F)(F)CC3CC4CC3C3C5CCC(C5)C43)CCCC2)c2ccccc12 |
| InChI | InChI=1S/C32H42F2O4S2/c1-2-3-14-37-28-12-13-29(26-9-5-4-8-25(26)28)39(15-6-7-16-39)38-40(35,36)32(33,34)20-24-18-23-19-27(24)31-22-11-10-21(17-22)30(23)31/h4-5,8-9,12-13,21-24,27,30-31H,2-3,6-7,10-11,14-20H2,1H3 |
| InChIKey | AGRYEFPYSZNKRM-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|