C32H33F3O4S2 — CID 159888885
2-(4-butoxynaphthalen-1-yl)thiolane;9H-fluorene;trifluoromethanesulfonic acid (PubChem CID 159888885) has the molecular formula C32H33F3O4S2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 2-(4-butoxynaphthalen-1-yl)thiolane;9H-fluorene;trifluoromethanesulfonic acid.
| Compound Name | 2-(4-butoxynaphthalen-1-yl)thiolane;9H-fluorene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 159888885 |
| Molecular Formula | C32H33F3O4S2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | 2-(4-butoxynaphthalen-1-yl)thiolane;9H-fluorene;trifluoromethanesulfonic acid |
| SMILES | CCCCOc1ccc(C2CCCS2)c2ccccc12.O=S(=O)(O)C(F)(F)F.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C18H22OS.C13H10.CHF3O3S/c1-2-3-12-19-17-11-10-16(18-9-6-13-20-18)14-7-4-5-8-15(14)17;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;2-1(3,4)8(5,6)7/h4-5,7-8,10-11,18H,2-3,6,9,12-13H2,1H3;1-8H,9H2;(H,5,6,7) |
| InChIKey | NUMKTAWYSDYEJF-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|