C29H49NO14 — CID 157184863
1-[bis[2-oxo-5-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentyl]amino]heptane-2,6-dione (PubChem CID 157184863) has the molecular formula C29H49NO14 and a molecular weight of 635.70 g/mol. Its IUPAC name is 1-[bis[2-oxo-5-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentyl]amino]heptane-2,6-dione.
| Compound Name | 1-[bis[2-oxo-5-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentyl]amino]heptane-2,6-dione |
|---|---|
| PubChem CID | 157184863 |
| Molecular Formula | C29H49NO14 |
| Molecular Weight | 635.70 g/mol |
| Exact Mass | 635.32 |
| IUPAC Name | 1-[bis[2-oxo-5-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxypentyl]amino]heptane-2,6-dione |
| SMILES | CC(=O)CCCC(=O)CN(CC(=O)CCCO[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O)CC(=O)CCCO[C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H49NO14/c1-16(31)7-4-8-19(32)13-30(14-20(33)9-5-11-41-28-26(39)24(37)22(35)17(2)43-28)15-21(34)10-6-12-42-29-27(40)25(38)23(36)18(3)44-29/h17-18,22-29,35-40H,4-15H2,1-3H3/t17-,18-,22+,23+,24+,25+,26-,27-,28+,29+/m0/s1 |
| InChIKey | OLQZFHKGLYGICI-MVXYXVPLSA-N |
| XLogP | -2.00 |
| TPSA | 229.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.70 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|