C42H40I2O10 — CID 157186641
[2-[7,19-bis[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-2-yl]-4,6-diiodophenyl] tert-butyl carbonate (PubChem CID 157186641) has the molecular formula C42H40I2O10 and a molecular weight of 958.58 g/mol. Its IUPAC name is [2-[7,19-bis[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-2-yl]-4,6-diiodophenyl] tert-butyl carbonate.
| Compound Name | [2-[7,19-bis[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-2-yl]-4,6-diiodophenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 157186641 |
| Molecular Formula | C42H40I2O10 |
| Molecular Weight | 958.58 g/mol |
| Exact Mass | 958.07 |
| IUPAC Name | [2-[7,19-bis[(2-methylpropan-2-yl)oxycarbonyloxy]-13-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaen-2-yl]-4,6-diiodophenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2c3c(ccc2c1)Oc1ccc2cc(OC(=O)OC(C)(C)C)ccc2c1C3c1cc(I)cc(I)c1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C42H40I2O10/c1-40(2,3)52-37(45)48-25-12-14-27-22(18-25)10-16-31-33(27)35(29-20-24(43)21-30(44)36(29)51-39(47)54-42(7,8)9)34-28-15-13-26(49-38(46)53-41(4,5)6)19-23(28)11-17-32(34)50-31/h10-21,35H,1-9H3 |
| InChIKey | VWPYFZYFAXYJAE-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.58 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|