C40H38I2O7 — CID 163516213
1,4-dimethoxybenzene;12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane (PubChem CID 163516213) has the molecular formula C40H38I2O7 and a molecular weight of 884.55 g/mol. Its IUPAC name is 1,4-dimethoxybenzene;12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane.
| Compound Name | 1,4-dimethoxybenzene;12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane |
|---|---|
| PubChem CID | 163516213 |
| Molecular Formula | C40H38I2O7 |
| Molecular Weight | 884.55 g/mol |
| Exact Mass | 884.07 |
| IUPAC Name | 1,4-dimethoxybenzene;12-(2,7-dimethoxynaphthalen-1-yl)-8,10-diiodo-2-methoxy-12H-benzo[a]xanthene;methoxymethane |
| SMILES | COC.COc1ccc(OC)cc1.COc1ccc2ccc(OC)c(C3c4cc(I)cc(I)c4Oc4ccc5ccc(OC)cc5c43)c2c1 |
| InChI | InChI=1S/C30H22I2O4.C8H10O2.C2H6O/c1-33-19-8-4-16-6-10-25(35-3)27(21(16)14-19)29-23-12-18(31)13-24(32)30(23)36-26-11-7-17-5-9-20(34-2)15-22(17)28(26)29;1-9-7-3-5-8(10-2)6-4-7;1-3-2/h4-15,29H,1-3H3;3-6H,1-2H3;1-2H3 |
| InChIKey | DGZAZASUZJTGLI-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.55 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|