C24H29ClN8O4S — CID 157188641
(2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 157188641) has the molecular formula C24H29ClN8O4S and a molecular weight of 561.07 g/mol. Its IUPAC name is (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 157188641 |
| Molecular Formula | C24H29ClN8O4S |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | (2R)-2-[2-[2-[(2S,4R)-4-amino-1-(6-chloroimidazo[1,2-a]pyridine-2-carbonyl)pyrrolidin-2-yl]-1,3-thiazol-4-yl]-2-oxoethyl]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | NC(N)=NCCCC[C@H](CC(=O)c1csc([C@@H]2C[C@@H](N)CN2C(=O)c2cn3cc(Cl)ccc3n2)n1)C(=O)O |
| InChI | InChI=1S/C24H29ClN8O4S/c25-14-4-5-20-30-16(11-32(20)9-14)22(35)33-10-15(26)8-18(33)21-31-17(12-38-21)19(34)7-13(23(36)37)3-1-2-6-29-24(27)28/h4-5,9,11-13,15,18H,1-3,6-8,10,26H2,(H,36,37)(H4,27,28,29)/t13-,15-,18+/m1/s1 |
| InChIKey | APKVJYLXHZLNRO-SIIHOXLZSA-N |
| XLogP | 2.08 |
| TPSA | 195.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|