About 3-methylbut-2-enoic acid;4-propylphenol
3-methylbut-2-enoic acid;4-propylphenol (PubChem CID 157200751) has the molecular formula C14H20O3
and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-methylbut-2-enoic acid;4-propylphenol.
Molecular Properties
| Compound Name | 3-methylbut-2-enoic acid;4-propylphenol |
| PubChem CID | 157200751 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3-methylbut-2-enoic acid;4-propylphenol |
| SMILES | CC(C)=CC(=O)O.CCCc1ccc(O)cc1 |
| InChI | InChI=1S/C9H12O.C5H8O2/c1-2-3-8-4-6-9(10)7-5-8;1-4(2)3-5(6)7/h4-7,10H,2-3H2,1H3;3H,1-2H3,(H,6,7) |
| InChIKey | AQTPITLSNFOJQT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enoic acid;4-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enoic acid;4-propylphenol?
The IUPAC name of 3-methylbut-2-enoic acid;4-propylphenol (CID 157200751) is 3-methylbut-2-enoic acid;4-propylphenol.
What is the SMILES notation for 3-methylbut-2-enoic acid;4-propylphenol?
The canonical SMILES for 3-methylbut-2-enoic acid;4-propylphenol is CC(C)=CC(=O)O.CCCc1ccc(O)cc1.
What is the InChIKey of 3-methylbut-2-enoic acid;4-propylphenol?
The InChIKey is AQTPITLSNFOJQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C5H8O2/c1-2-3-8-4-6-9(10)7-5-8;1-4(2)3-5(6)7/h4-7,10H,2-3H2,1H3;3H,1-2H3,(H,6,7).
What are the key properties of 3-methylbut-2-enoic acid;4-propylphenol?
3-methylbut-2-enoic acid;4-propylphenol has a molecular weight of 236.31 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enoic acid;4-propylphenol is sourced from PubChem (CID 157200751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).