About 4-(2,2-difluoroethoxy)-N,3-dimethylaniline
4-(2,2-difluoroethoxy)-N,3-dimethylaniline (PubChem CID 157201816) has the molecular formula C10H13F2NO
and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 4-(2,2-difluoroethoxy)-N,3-dimethylaniline |
| PubChem CID | 157201816 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N,3-dimethylaniline |
| SMILES | CNc1ccc(OCC(F)F)c(C)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-7-5-8(13-2)3-4-9(7)14-6-10(11)12/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | AQWQEGBBFOOFAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2-difluoroethoxy)-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2-difluoroethoxy)-N,3-dimethylaniline?
The IUPAC name of 4-(2,2-difluoroethoxy)-N,3-dimethylaniline (CID 157201816) is 4-(2,2-difluoroethoxy)-N,3-dimethylaniline.
What is the SMILES notation for 4-(2,2-difluoroethoxy)-N,3-dimethylaniline?
The canonical SMILES for 4-(2,2-difluoroethoxy)-N,3-dimethylaniline is CNc1ccc(OCC(F)F)c(C)c1.
What is the InChIKey of 4-(2,2-difluoroethoxy)-N,3-dimethylaniline?
The InChIKey is AQWQEGBBFOOFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F2NO/c1-7-5-8(13-2)3-4-9(7)14-6-10(11)12/h3-5,10,13H,6H2,1-2H3.
What are the key properties of 4-(2,2-difluoroethoxy)-N,3-dimethylaniline?
4-(2,2-difluoroethoxy)-N,3-dimethylaniline has a molecular weight of 201.22 g/mol, XLogP of 2.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2-difluoroethoxy)-N,3-dimethylaniline is sourced from PubChem (CID 157201816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).