C10H13F2NO — CID 157201816
4-(2,2-difluoroethoxy)-N,3-dimethylaniline (PubChem CID 157201816) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N,3-dimethylaniline.
| Compound Name | 4-(2,2-difluoroethoxy)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 157201816 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N,3-dimethylaniline |
| SMILES | CNc1ccc(OCC(F)F)c(C)c1 |
| InChI | InChI=1S/C10H13F2NO/c1-7-5-8(13-2)3-4-9(7)14-6-10(11)12/h3-5,10,13H,6H2,1-2H3 |
| InChIKey | AQWQEGBBFOOFAX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|