C26H22N2O8S2 — CID 157215025
5-[(6-acetylnaphthalene-2-carbonyl)amino]-2-[4-(methylamino)phenyl]benzenesulfonic acid;sulfur trioxide (PubChem CID 157215025) has the molecular formula C26H22N2O8S2 and a molecular weight of 554.60 g/mol. Its IUPAC name is 5-[(6-acetylnaphthalene-2-carbonyl)amino]-2-[4-(methylamino)phenyl]benzenesulfonic acid;sulfur trioxide.
| Compound Name | 5-[(6-acetylnaphthalene-2-carbonyl)amino]-2-[4-(methylamino)phenyl]benzenesulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 157215025 |
| Molecular Formula | C26H22N2O8S2 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | 5-[(6-acetylnaphthalene-2-carbonyl)amino]-2-[4-(methylamino)phenyl]benzenesulfonic acid;sulfur trioxide |
| SMILES | CNc1ccc(-c2ccc(NC(=O)c3ccc4cc(C(C)=O)ccc4c3)cc2S(=O)(=O)O)cc1.O=S(=O)=O |
| InChI | InChI=1S/C26H22N2O5S.O3S/c1-16(29)18-3-4-20-14-21(6-5-19(20)13-18)26(30)28-23-11-12-24(25(15-23)34(31,32)33)17-7-9-22(27-2)10-8-17;1-4(2)3/h3-15,27H,1-2H3,(H,28,30)(H,31,32,33); |
| InChIKey | ASHVJZJMHXTCPE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|