C22H22N2O8S2 — CID 164984356
2-[4-[(4-acetylbenzoyl)amino]phenyl]-5-(methylamino)benzenesulfonic acid;molecular hydrogen;sulfur trioxide (PubChem CID 164984356) has the molecular formula C22H22N2O8S2 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[4-[(4-acetylbenzoyl)amino]phenyl]-5-(methylamino)benzenesulfonic acid;molecular hydrogen;sulfur trioxide.
| Compound Name | 2-[4-[(4-acetylbenzoyl)amino]phenyl]-5-(methylamino)benzenesulfonic acid;molecular hydrogen;sulfur trioxide |
|---|---|
| PubChem CID | 164984356 |
| Molecular Formula | C22H22N2O8S2 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-[4-[(4-acetylbenzoyl)amino]phenyl]-5-(methylamino)benzenesulfonic acid;molecular hydrogen;sulfur trioxide |
| SMILES | CNc1ccc(-c2ccc(NC(=O)c3ccc(C(C)=O)cc3)cc2)c(S(=O)(=O)O)c1.O=S(=O)=O.[H][H] |
| InChI | InChI=1S/C22H20N2O5S.O3S.H2/c1-14(25)15-3-5-17(6-4-15)22(26)24-18-9-7-16(8-10-18)20-12-11-19(23-2)13-21(20)30(27,28)29;1-4(2)3;/h3-13,23H,1-2H3,(H,24,26)(H,27,28,29);;1H |
| InChIKey | FYEWUSWSPCJFQV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 163.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|