C28H31Cl2F2N5O7S — CID 157216893
tert-butyl 3-[5-chloro-4-(1,1-difluoro-2-hydroxy-2-methylpropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;1-chloropyrrolidine-2,5-dione (PubChem CID 157216893) has the molecular formula C28H31Cl2F2N5O7S and a molecular weight of 690.55 g/mol. Its IUPAC name is tert-butyl 3-[5-chloro-4-(1,1-difluoro-2-hydroxy-2-methylpropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;1-chloropyrrolidine-2,5-dione.
| Compound Name | tert-butyl 3-[5-chloro-4-(1,1-difluoro-2-hydroxy-2-methylpropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;1-chloropyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 157216893 |
| Molecular Formula | C28H31Cl2F2N5O7S |
| Molecular Weight | 690.55 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | tert-butyl 3-[5-chloro-4-(1,1-difluoro-2-hydroxy-2-methylpropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate;1-chloropyrrolidine-2,5-dione |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(c1nc3c(OC(F)(F)C(C)(C)O)c(Cl)cc(-c4nccs4)c3o1)C2.O=C1CCC(=O)N1Cl |
| InChI | InChI=1S/C24H27ClF2N4O5S.C4H4ClNO2/c1-22(2,3)36-21(32)31-12-8-13(31)11-30(10-12)20-29-16-17(34-20)14(19-28-6-7-37-19)9-15(25)18(16)35-24(26,27)23(4,5)33;5-6-3(7)1-2-4(6)8/h6-7,9,12-13,33H,8,10-11H2,1-5H3;1-2H2 |
| InChIKey | ASNICOUDXIDROV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.55 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|