C23H32F3N5O2 — CID 157223329
5,8-diethyl-2-[[3-[(3,4,5-trifluorophenoxy)methyl]cyclobutyl]amino]-7H-pteridin-6-one;methane (PubChem CID 157223329) has the molecular formula C23H32F3N5O2 and a molecular weight of 467.54 g/mol. Its IUPAC name is 5,8-diethyl-2-[[3-[(3,4,5-trifluorophenoxy)methyl]cyclobutyl]amino]-7H-pteridin-6-one;methane.
| Compound Name | 5,8-diethyl-2-[[3-[(3,4,5-trifluorophenoxy)methyl]cyclobutyl]amino]-7H-pteridin-6-one;methane |
|---|---|
| PubChem CID | 157223329 |
| Molecular Formula | C23H32F3N5O2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 5,8-diethyl-2-[[3-[(3,4,5-trifluorophenoxy)methyl]cyclobutyl]amino]-7H-pteridin-6-one;methane |
| SMILES | C.C.CCN1CC(=O)N(CC)c2cnc(NC3CC(COc4cc(F)c(F)c(F)c4)C3)nc21 |
| InChI | InChI=1S/C21H24F3N5O2.2CH4/c1-3-28-10-18(30)29(4-2)17-9-25-21(27-20(17)28)26-13-5-12(6-13)11-31-14-7-15(22)19(24)16(23)8-14;;/h7-9,12-13H,3-6,10-11H2,1-2H3,(H,25,26,27);2*1H4 |
| InChIKey | ATGDUUWQSBHFEG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|