C22H29F3N4O2S2 — CID 159764589
5,8-diethyl-2-[[(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentyl]methyl]-7H-pteridin-6-one;sulfane (PubChem CID 159764589) has the molecular formula C22H29F3N4O2S2 and a molecular weight of 502.63 g/mol. Its IUPAC name is 5,8-diethyl-2-[[(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentyl]methyl]-7H-pteridin-6-one;sulfane.
| Compound Name | 5,8-diethyl-2-[[(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentyl]methyl]-7H-pteridin-6-one;sulfane |
|---|---|
| PubChem CID | 159764589 |
| Molecular Formula | C22H29F3N4O2S2 |
| Molecular Weight | 502.63 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | 5,8-diethyl-2-[[(1R,3S)-3-(3,4,5-trifluorophenoxy)cyclopentyl]methyl]-7H-pteridin-6-one;sulfane |
| SMILES | CCN1CC(=O)N(CC)c2cnc(C[C@H]3CC[C@H](Oc4cc(F)c(F)c(F)c4)C3)nc21.S.S |
| InChI | InChI=1S/C22H25F3N4O2.2H2S/c1-3-28-12-20(30)29(4-2)18-11-26-19(27-22(18)28)8-13-5-6-14(7-13)31-15-9-16(23)21(25)17(24)10-15;;/h9-11,13-14H,3-8,12H2,1-2H3;2*1H2/t13-,14-;;/m0../s1 |
| InChIKey | NFIJTRVWAANALC-AXEKQOJOSA-N |
| XLogP | 4.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|