About N,N-diethylpropanamide;propane;propanenitrile
N,N-diethylpropanamide;propane;propanenitrile (PubChem CID 157233507) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is N,N-diethylpropanamide;propane;propanenitrile.
Molecular Properties
| Compound Name | N,N-diethylpropanamide;propane;propanenitrile |
| PubChem CID | 157233507 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | N,N-diethylpropanamide;propane;propanenitrile |
| SMILES | CCC.CCC#N.CCC(=O)N(CC)CC |
| InChI | InChI=1S/C7H15NO.C3H5N.C3H8/c1-4-7(9)8(5-2)6-3;1-2-3-4;1-3-2/h4-6H2,1-3H3;2H2,1H3;3H2,1-2H3 |
| InChIKey | AUJIKTOYPWLKKF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-diethylpropanamide;propane;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylpropanamide;propane;propanenitrile?
The IUPAC name of N,N-diethylpropanamide;propane;propanenitrile (CID 157233507) is N,N-diethylpropanamide;propane;propanenitrile.
What is the SMILES notation for N,N-diethylpropanamide;propane;propanenitrile?
The canonical SMILES for N,N-diethylpropanamide;propane;propanenitrile is CCC.CCC#N.CCC(=O)N(CC)CC.
What is the InChIKey of N,N-diethylpropanamide;propane;propanenitrile?
The InChIKey is AUJIKTOYPWLKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C3H5N.C3H8/c1-4-7(9)8(5-2)6-3;1-2-3-4;1-3-2/h4-6H2,1-3H3;2H2,1H3;3H2,1-2H3.
What are the key properties of N,N-diethylpropanamide;propane;propanenitrile?
N,N-diethylpropanamide;propane;propanenitrile has a molecular weight of 228.38 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylpropanamide;propane;propanenitrile is sourced from PubChem (CID 157233507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).