C35H33FN2O8 — CID 157237475
prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 157237475) has the molecular formula C35H33FN2O8 and a molecular weight of 628.65 g/mol. Its IUPAC name is prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 157237475 |
| Molecular Formula | C35H33FN2O8 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | prop-2-enyl (2S,3S,4S,5R)-6-[4-[1-(4-fluorophenyl)-2-propan-2-yl-5H-pyrrolo[3,4-f]indol-3-yl]benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1OC(OC(=O)c2ccc(-c3c(C(C)C)n(-c4ccc(F)cc4)c4cc5c(cc34)CN=C5)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C35H33FN2O8/c1-4-13-44-34(43)32-30(40)29(39)31(41)35(45-32)46-33(42)20-7-5-19(6-8-20)27-25-14-21-16-37-17-22(21)15-26(25)38(28(27)18(2)3)24-11-9-23(36)10-12-24/h4-12,14-15,17-18,29-32,35,39-41H,1,13,16H2,2-3H3/t29-,30-,31+,32-,35?/m0/s1 |
| InChIKey | WCWXFFDGOGTRHA-KHGAUMIWSA-N |
| XLogP | 4.19 |
| TPSA | 139.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|