C9H18N2O2 — CID 157242998
(2S)-2,5-dimethyl-5-(methylamino)-4-oxohexanamide (PubChem CID 157242998) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S)-2,5-dimethyl-5-(methylamino)-4-oxohexanamide.
| Compound Name | (2S)-2,5-dimethyl-5-(methylamino)-4-oxohexanamide |
|---|---|
| PubChem CID | 157242998 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (2S)-2,5-dimethyl-5-(methylamino)-4-oxohexanamide |
| SMILES | CNC(C)(C)C(=O)C[C@H](C)C(N)=O |
| InChI | InChI=1S/C9H18N2O2/c1-6(8(10)13)5-7(12)9(2,3)11-4/h6,11H,5H2,1-4H3,(H2,10,13)/t6-/m0/s1 |
| InChIKey | BAIGCRNFJRHIPM-LURJTMIESA-N |
| XLogP | 0.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |