About cyanoiminomethylideneazanide;diaminomethylideneazanium
cyanoiminomethylideneazanide;diaminomethylideneazanium (PubChem CID 157246509) has the molecular formula C3H6N6
and a molecular weight of 126.12 g/mol. Its IUPAC name is cyanoiminomethylideneazanide;diaminomethylideneazanium.
Molecular Properties
| Compound Name | cyanoiminomethylideneazanide;diaminomethylideneazanium |
| PubChem CID | 157246509 |
| Molecular Formula | C3H6N6 |
| Molecular Weight | 126.12 g/mol |
| Exact Mass | 126.07 |
| IUPAC Name | cyanoiminomethylideneazanide;diaminomethylideneazanium |
| SMILES | N#CN=C=[N-].NC(N)=[NH2+] |
| InChI | InChI=1S/C2N3.CH5N3/c3-1-5-2-4;2-1(3)4/h;(H5,2,3,4)/q-1;/p+1 |
| InChIKey | AVVIWYTXJGYSKH-UHFFFAOYSA-O |
| XLogP | -2.77 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.12 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cyanoiminomethylideneazanide;diaminomethylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanoiminomethylideneazanide;diaminomethylideneazanium?
The IUPAC name of cyanoiminomethylideneazanide;diaminomethylideneazanium (CID 157246509) is cyanoiminomethylideneazanide;diaminomethylideneazanium.
What is the SMILES notation for cyanoiminomethylideneazanide;diaminomethylideneazanium?
The canonical SMILES for cyanoiminomethylideneazanide;diaminomethylideneazanium is N#CN=C=[N-].NC(N)=[NH2+].
What is the InChIKey of cyanoiminomethylideneazanide;diaminomethylideneazanium?
The InChIKey is AVVIWYTXJGYSKH-UHFFFAOYSA-O. The full InChI is InChI=1S/C2N3.CH5N3/c3-1-5-2-4;2-1(3)4/h;(H5,2,3,4)/q-1;/p+1.
What are the key properties of cyanoiminomethylideneazanide;diaminomethylideneazanium?
cyanoiminomethylideneazanide;diaminomethylideneazanium has a molecular weight of 126.12 g/mol, XLogP of -2.77, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyanoiminomethylideneazanide;diaminomethylideneazanium is sourced from PubChem (CID 157246509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).