About azane;2-cyanoguanidine
azane;2-cyanoguanidine (PubChem CID 21470607) has the molecular formula C2H7N5
and a molecular weight of 101.11 g/mol. Its IUPAC name is azane;2-cyanoguanidine.
Molecular Properties
| Compound Name | azane;2-cyanoguanidine |
| PubChem CID | 21470607 |
| Molecular Formula | C2H7N5 |
| Molecular Weight | 101.11 g/mol |
| Exact Mass | 101.07 |
| IUPAC Name | azane;2-cyanoguanidine |
| SMILES | N.N#CN=C(N)N |
| InChI | InChI=1S/C2H4N4.H3N/c3-1-6-2(4)5;/h(H4,4,5,6);1H3 |
| InChIKey | NUNLHSMRVNBTNF-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.11 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azane;2-cyanoguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-cyanoguanidine?
The IUPAC name of azane;2-cyanoguanidine (CID 21470607) is azane;2-cyanoguanidine.
What is the SMILES notation for azane;2-cyanoguanidine?
The canonical SMILES for azane;2-cyanoguanidine is N.N#CN=C(N)N.
What is the InChIKey of azane;2-cyanoguanidine?
The InChIKey is NUNLHSMRVNBTNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.H3N/c3-1-6-2(4)5;/h(H4,4,5,6);1H3.
What are the key properties of azane;2-cyanoguanidine?
azane;2-cyanoguanidine has a molecular weight of 101.11 g/mol, XLogP of -1.10, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-cyanoguanidine is sourced from PubChem (CID 21470607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).