C11H22N4 — CID 157251840
N'-butylethanimidamide;5-ethyl-1H-imidazole (PubChem CID 157251840) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is N'-butylethanimidamide;5-ethyl-1H-imidazole.
| Compound Name | N'-butylethanimidamide;5-ethyl-1H-imidazole |
|---|---|
| PubChem CID | 157251840 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | N'-butylethanimidamide;5-ethyl-1H-imidazole |
| SMILES | CCCC/N=C(\C)N.CCc1cnc[nH]1 |
| InChI | InChI=1S/C6H14N2.C5H8N2/c1-3-4-5-8-6(2)7;1-2-5-3-6-4-7-5/h3-5H2,1-2H3,(H2,7,8);3-4H,2H2,1H3,(H,6,7) |
| InChIKey | AWKYMQCELMUJQF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|