C36H30F4N4O2 — CID 157256714
(4Z)-2-(3',5'-difluorospiro[1,3-dihydroperimidine-2,1'-cyclohexane]-4-yl)-4-(3',5'-difluorospiro[1H-perimidine-2,1'-cyclohexane]-4-ylidene)-3-hydroxycyclobut-2-en-1-one (PubChem CID 157256714) has the molecular formula C36H30F4N4O2 and a molecular weight of 626.65 g/mol. Its IUPAC name is (4Z)-2-(3',5'-difluorospiro[1,3-dihydroperimidine-2,1'-cyclohexane]-4-yl)-4-(3',5'-difluorospiro[1H-perimidine-2,1'-cyclohexane]-4-ylidene)-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4Z)-2-(3',5'-difluorospiro[1,3-dihydroperimidine-2,1'-cyclohexane]-4-yl)-4-(3',5'-difluorospiro[1H-perimidine-2,1'-cyclohexane]-4-ylidene)-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 157256714 |
| Molecular Formula | C36H30F4N4O2 |
| Molecular Weight | 626.65 g/mol |
| Exact Mass | 626.23 |
| IUPAC Name | (4Z)-2-(3',5'-difluorospiro[1,3-dihydroperimidine-2,1'-cyclohexane]-4-yl)-4-(3',5'-difluorospiro[1H-perimidine-2,1'-cyclohexane]-4-ylidene)-3-hydroxycyclobut-2-en-1-one |
| SMILES | O=C1C(c2ccc3cccc4c3c2NC2(CC(F)CC(F)C2)N4)=C(O)/C1=c1\ccc2cccc3c2c1=NC1(CC(F)CC(F)C1)N3 |
| InChI | InChI=1S/C36H30F4N4O2/c37-19-11-20(38)14-35(13-19)41-25-5-1-3-17-7-9-23(31(43-35)27(17)25)29-33(45)30(34(29)46)24-10-8-18-4-2-6-26-28(18)32(24)44-36(42-26)15-21(39)12-22(40)16-36/h1-10,19-22,41-43,45H,11-16H2/b30-24- |
| InChIKey | VQCRNAMREJDOFB-KRUMMXJUSA-N |
| XLogP | 6.69 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.65 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|