C44H50N4O2 — CID 90732046
2-(1',1',5',5'-tetramethylspiro[1,3-dihydroperimidine-2,3'-cyclohexane]-4-yl)-4-(1',1',5',5'-tetramethylspiro[1H-perimidine-2,3'-cyclohexane]-4-ylidene)cyclobutane-1,3-dione (PubChem CID 90732046) has the molecular formula C44H50N4O2 and a molecular weight of 666.91 g/mol. Its IUPAC name is 2-(1',1',5',5'-tetramethylspiro[1,3-dihydroperimidine-2,3'-cyclohexane]-4-yl)-4-(1',1',5',5'-tetramethylspiro[1H-perimidine-2,3'-cyclohexane]-4-ylidene)cyclobutane-1,3-dione.
| Compound Name | 2-(1',1',5',5'-tetramethylspiro[1,3-dihydroperimidine-2,3'-cyclohexane]-4-yl)-4-(1',1',5',5'-tetramethylspiro[1H-perimidine-2,3'-cyclohexane]-4-ylidene)cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 90732046 |
| Molecular Formula | C44H50N4O2 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | 2-(1',1',5',5'-tetramethylspiro[1,3-dihydroperimidine-2,3'-cyclohexane]-4-yl)-4-(1',1',5',5'-tetramethylspiro[1H-perimidine-2,3'-cyclohexane]-4-ylidene)cyclobutane-1,3-dione |
| SMILES | CC1(C)CC(C)(C)CC2(C1)N=c1c(=C3C(=O)C(c4ccc5cccc6c5c4NC4(CC(C)(C)CC(C)(C)C4)N6)C3=O)ccc3cccc(c13)N2 |
| InChI | InChI=1S/C44H50N4O2/c1-39(2)19-40(3,4)22-43(21-39)45-29-13-9-11-25-15-17-27(35(47-43)31(25)29)33-37(49)34(38(33)50)28-18-16-26-12-10-14-30-32(26)36(28)48-44(46-30)23-41(5,6)20-42(7,8)24-44/h9-18,33,45-47H,19-24H2,1-8H3/b34-28- |
| InChIKey | BHNDWZUIGJTQFD-BFYITVNDSA-N |
| XLogP | 8.83 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|