C30H22N4O6-2 — CID 59171464
2,4-bis(2,2-diformyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate (PubChem CID 59171464) has the molecular formula C30H22N4O6-2 and a molecular weight of 534.53 g/mol. Its IUPAC name is 2,4-bis(2,2-diformyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis(2,2-diformyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 59171464 |
| Molecular Formula | C30H22N4O6-2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 2,4-bis(2,2-diformyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate |
| SMILES | O=CC1(C=O)Nc2cccc3ccc(C4C([O-])C(c5ccc6cccc7c6c5NC(C=O)(C=O)N7)C4[O-])c(c23)N1 |
| InChI | InChI=1S/C30H22N4O6/c35-11-29(12-36)31-19-5-1-3-15-7-9-17(25(33-29)21(15)19)23-27(39)24(28(23)40)18-10-8-16-4-2-6-20-22(16)26(18)34-30(13-37,14-38)32-20/h1-14,23-24,27-28,31-34H/q-2 |
| InChIKey | CHFFLSPLUISLIC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 162.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|