C52H60B2N4O4-2 — CID 153294125
2,4-bis[3-[4-(2-ethylhexoxy)phenyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl]cyclobutane-1,3-diolate (PubChem CID 153294125) has the molecular formula C52H60B2N4O4-2 and a molecular weight of 826.70 g/mol. Its IUPAC name is 2,4-bis[3-[4-(2-ethylhexoxy)phenyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[3-[4-(2-ethylhexoxy)phenyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 153294125 |
| Molecular Formula | C52H60B2N4O4-2 |
| Molecular Weight | 826.70 g/mol |
| Exact Mass | 826.48 |
| IUPAC Name | 2,4-bis[3-[4-(2-ethylhexoxy)phenyl]-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl]cyclobutane-1,3-diolate |
| SMILES | CCCCC(CC)COc1ccc(B2Nc3cccc4ccc(C5C([O-])C(c6ccc7cccc8c7c6NB(c6ccc(OCC(CC)CCCC)cc6)N8)C5[O-])c(c34)N2)cc1 |
| InChI | InChI=1S/C52H60B2N4O4/c1-5-9-13-33(7-3)31-61-39-25-21-37(22-26-39)53-55-43-17-11-15-35-19-29-41(49(57-53)45(35)43)47-51(59)48(52(47)60)42-30-20-36-16-12-18-44-46(36)50(42)58-54(56-44)38-23-27-40(28-24-38)62-32-34(8-4)14-10-6-2/h11-12,15-30,33-34,47-48,51-52,55-58H,5-10,13-14,31-32H2,1-4H3/q-2 |
| InChIKey | OXRLLOLUTZKDCX-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.70 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|