C50H62N4O2-2 — CID 58828066
2,4-bis(2,2-dicyclohexyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate (PubChem CID 58828066) has the molecular formula C50H62N4O2-2 and a molecular weight of 751.07 g/mol. Its IUPAC name is 2,4-bis(2,2-dicyclohexyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis(2,2-dicyclohexyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 58828066 |
| Molecular Formula | C50H62N4O2-2 |
| Molecular Weight | 751.07 g/mol |
| Exact Mass | 750.49 |
| IUPAC Name | 2,4-bis(2,2-dicyclohexyl-1,3-dihydroperimidin-4-yl)cyclobutane-1,3-diolate |
| SMILES | [O-]C1C(c2ccc3cccc4c3c2NC(C2CCCCC2)(C2CCCCC2)N4)C([O-])C1c1ccc2cccc3c2c1NC(C1CCCCC1)(C1CCCCC1)N3 |
| InChI | InChI=1S/C50H62N4O2/c55-47-43(37-29-27-31-15-13-25-39-41(31)45(37)53-49(51-39,33-17-5-1-6-18-33)34-19-7-2-8-20-34)48(56)44(47)38-30-28-32-16-14-26-40-42(32)46(38)54-50(52-40,35-21-9-3-10-22-35)36-23-11-4-12-24-36/h13-16,25-30,33-36,43-44,47-48,51-54H,1-12,17-24H2/q-2 |
| InChIKey | PMDPRIVIEROGGS-UHFFFAOYSA-N |
| XLogP | 10.72 |
| TPSA | 94.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.07 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|