C30H26O6-2 — CID 154619553
2,4-bis(3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl)cyclobutane-1,3-diolate (PubChem CID 154619553) has the molecular formula C30H26O6-2 and a molecular weight of 482.53 g/mol. Its IUPAC name is 2,4-bis(3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl)cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis(3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl)cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619553 |
| Molecular Formula | C30H26O6-2 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 2,4-bis(3,3-dimethyl-2,4-dioxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-6-yl)cyclobutane-1,3-diolate |
| SMILES | CC1(C)Oc2cccc3ccc(C4C([O-])C(c5ccc6cccc7c6c5OC(C)(C)O7)C4[O-])c(c23)O1 |
| InChI | InChI=1S/C30H26O6/c1-29(2)33-19-9-5-7-15-11-13-17(27(35-29)21(15)19)23-25(31)24(26(23)32)18-14-12-16-8-6-10-20-22(16)28(18)36-30(3,4)34-20/h5-14,23-26H,1-4H3/q-2 |
| InChIKey | VNOOLUVXKLTQGV-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |