C25H36N6O — CID 157258578
4,6-dimethyl-N-pent-3-ynylpyrimidin-2-amine;N-(4,6-dimethylpyrimidin-2-yl)-N-pent-3-ynylacetamide;methane (PubChem CID 157258578) has the molecular formula C25H36N6O and a molecular weight of 436.60 g/mol. Its IUPAC name is 4,6-dimethyl-N-pent-3-ynylpyrimidin-2-amine;N-(4,6-dimethylpyrimidin-2-yl)-N-pent-3-ynylacetamide;methane.
| Compound Name | 4,6-dimethyl-N-pent-3-ynylpyrimidin-2-amine;N-(4,6-dimethylpyrimidin-2-yl)-N-pent-3-ynylacetamide;methane |
|---|---|
| PubChem CID | 157258578 |
| Molecular Formula | C25H36N6O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | 4,6-dimethyl-N-pent-3-ynylpyrimidin-2-amine;N-(4,6-dimethylpyrimidin-2-yl)-N-pent-3-ynylacetamide;methane |
| SMILES | C.CC#CCCN(C(C)=O)c1nc(C)cc(C)n1.CC#CCCNc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C13H17N3O.C11H15N3.CH4/c1-5-6-7-8-16(12(4)17)13-14-10(2)9-11(3)15-13;1-4-5-6-7-12-11-13-9(2)8-10(3)14-11;/h9H,7-8H2,1-4H3;8H,6-7H2,1-3H3,(H,12,13,14);1H4 |
| InChIKey | AXELDTSUHBNRKU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|