C24H26N4O4S — CID 157259479
2-[(3R)-5-amino-6,6-dimethyl-1,1-dioxospiro[2H-1,4-thiazine-3,8'-6,7-dihydro-5H-naphthalene]-2'-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone (PubChem CID 157259479) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 2-[(3R)-5-amino-6,6-dimethyl-1,1-dioxospiro[2H-1,4-thiazine-3,8'-6,7-dihydro-5H-naphthalene]-2'-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone.
| Compound Name | 2-[(3R)-5-amino-6,6-dimethyl-1,1-dioxospiro[2H-1,4-thiazine-3,8'-6,7-dihydro-5H-naphthalene]-2'-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 157259479 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 2-[(3R)-5-amino-6,6-dimethyl-1,1-dioxospiro[2H-1,4-thiazine-3,8'-6,7-dihydro-5H-naphthalene]-2'-yl]-1-(5-prop-2-ynoxypyrazin-2-yl)ethanone |
| SMILES | C#CCOc1cnc(C(=O)Cc2ccc3c(c2)[C@]2(CCC3)CS(=O)(=O)C(C)(C)C(N)=N2)cn1 |
| InChI | InChI=1S/C24H26N4O4S/c1-4-10-32-21-14-26-19(13-27-21)20(29)12-16-7-8-17-6-5-9-24(18(17)11-16)15-33(30,31)23(2,3)22(25)28-24/h1,7-8,11,13-14H,5-6,9-10,12,15H2,2-3H3,(H2,25,28)/t24-/m0/s1 |
| InChIKey | VEWYNKSOJUAJKF-DEOSSOPVSA-N |
| XLogP | 2.01 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|