C18H21Cl2N7 — CID 157260263
3-[4-(aminomethyl)-4-methylpiperidin-1-yl]-N-(2,3-dichloro-4-pyridinyl)-5H-pyrrolo[3,4-b]pyrazin-7-amine (PubChem CID 157260263) has the molecular formula C18H21Cl2N7 and a molecular weight of 406.32 g/mol. Its IUPAC name is 3-[4-(aminomethyl)-4-methylpiperidin-1-yl]-N-(2,3-dichloro-4-pyridinyl)-5H-pyrrolo[3,4-b]pyrazin-7-amine.
| Compound Name | 3-[4-(aminomethyl)-4-methylpiperidin-1-yl]-N-(2,3-dichloro-4-pyridinyl)-5H-pyrrolo[3,4-b]pyrazin-7-amine |
|---|---|
| PubChem CID | 157260263 |
| Molecular Formula | C18H21Cl2N7 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 3-[4-(aminomethyl)-4-methylpiperidin-1-yl]-N-(2,3-dichloro-4-pyridinyl)-5H-pyrrolo[3,4-b]pyrazin-7-amine |
| SMILES | CC1(CN)CCN(c2cnc3c(n2)CN=C3Nc2ccnc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C18H21Cl2N7/c1-18(10-21)3-6-27(7-4-18)13-9-23-15-12(25-13)8-24-17(15)26-11-2-5-22-16(20)14(11)19/h2,5,9H,3-4,6-8,10,21H2,1H3,(H,22,24,26) |
| InChIKey | ONSHADUSXWNTBZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|