C17H25ClN8O — CID 142337795
3-[amino-[(2-amino-3-chloro-4-pyridinyl)oxy]methyl]-6-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-amine (PubChem CID 142337795) has the molecular formula C17H25ClN8O and a molecular weight of 392.90 g/mol. Its IUPAC name is 3-[amino-[(2-amino-3-chloro-4-pyridinyl)oxy]methyl]-6-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-amine.
| Compound Name | 3-[amino-[(2-amino-3-chloro-4-pyridinyl)oxy]methyl]-6-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 142337795 |
| Molecular Formula | C17H25ClN8O |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[amino-[(2-amino-3-chloro-4-pyridinyl)oxy]methyl]-6-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazin-2-amine |
| SMILES | CC1(CN)CCN(c2cnc(C(N)Oc3ccnc(N)c3Cl)c(N)n2)CC1 |
| InChI | InChI=1S/C17H25ClN8O/c1-17(9-19)3-6-26(7-4-17)11-8-24-13(15(21)25-11)16(22)27-10-2-5-23-14(20)12(10)18/h2,5,8,16H,3-4,6-7,9,19,22H2,1H3,(H2,20,23)(H2,21,25) |
| InChIKey | DZNAYWMIMBQJMX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 155.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|