C18H25N7 — CID 166992583
6-[4-(aminomethyl)-4-methylpiperidin-1-yl]-3-(3-methylpyridine-4-carboximidoyl)pyrazin-2-amine (PubChem CID 166992583) has the molecular formula C18H25N7 and a molecular weight of 339.45 g/mol. Its IUPAC name is 6-[4-(aminomethyl)-4-methylpiperidin-1-yl]-3-(3-methylpyridine-4-carboximidoyl)pyrazin-2-amine.
| Compound Name | 6-[4-(aminomethyl)-4-methylpiperidin-1-yl]-3-(3-methylpyridine-4-carboximidoyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 166992583 |
| Molecular Formula | C18H25N7 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 6-[4-(aminomethyl)-4-methylpiperidin-1-yl]-3-(3-methylpyridine-4-carboximidoyl)pyrazin-2-amine |
| SMILES | [H]/N=C(\c1ccncc1C)c1ncc(N2CCC(C)(CN)CC2)nc1N |
| InChI | InChI=1S/C18H25N7/c1-12-9-22-6-3-13(12)15(20)16-17(21)24-14(10-23-16)25-7-4-18(2,11-19)5-8-25/h3,6,9-10,20H,4-5,7-8,11,19H2,1-2H3,(H2,21,24)/b20-15+ |
| InChIKey | ZUFWMLATWSWPIL-HMMYKYKNSA-N |
| XLogP | 1.74 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|