C18H24ClN7O — CID 146642179
(3-chloro-2-methyl-4-pyridinyl) 3-amino-5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazine-2-carboximidate (PubChem CID 146642179) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is (3-chloro-2-methyl-4-pyridinyl) 3-amino-5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazine-2-carboximidate.
| Compound Name | (3-chloro-2-methyl-4-pyridinyl) 3-amino-5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazine-2-carboximidate |
|---|---|
| PubChem CID | 146642179 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | (3-chloro-2-methyl-4-pyridinyl) 3-amino-5-[4-(aminomethyl)-4-methylpiperidin-1-yl]pyrazine-2-carboximidate |
| SMILES | [H]/N=C(\Oc1ccnc(C)c1Cl)c1ncc(N2CCC(C)(CN)CC2)nc1N |
| InChI | InChI=1S/C18H24ClN7O/c1-11-14(19)12(3-6-23-11)27-17(22)15-16(21)25-13(9-24-15)26-7-4-18(2,10-20)5-8-26/h3,6,9,22H,4-5,7-8,10,20H2,1-2H3,(H2,21,25)/b22-17- |
| InChIKey | ZLDPGDXKWNLWMG-XLNRJJMWSA-N |
| XLogP | 2.39 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|