C24H26O8 — CID 157262863
2-(6-methoxy-1-benzofuran-5-yl)ethanol;2-[2-(6-methoxy-1-benzofuran-5-yl)ethoxy]acetic acid (PubChem CID 157262863) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-5-yl)ethanol;2-[2-(6-methoxy-1-benzofuran-5-yl)ethoxy]acetic acid.
| Compound Name | 2-(6-methoxy-1-benzofuran-5-yl)ethanol;2-[2-(6-methoxy-1-benzofuran-5-yl)ethoxy]acetic acid |
|---|---|
| PubChem CID | 157262863 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-5-yl)ethanol;2-[2-(6-methoxy-1-benzofuran-5-yl)ethoxy]acetic acid |
| SMILES | COc1cc2occc2cc1CCO.COc1cc2occc2cc1CCOCC(=O)O |
| InChI | InChI=1S/C13H14O5.C11H12O3/c1-16-11-7-12-10(3-5-18-12)6-9(11)2-4-17-8-13(14)15;1-13-10-7-11-9(3-5-14-11)6-8(10)2-4-12/h3,5-7H,2,4,8H2,1H3,(H,14,15);3,5-7,12H,2,4H2,1H3 |
| InChIKey | AXQXMEDPZPLGJK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|