C36H44N2O10 — CID 66588437
bis[1-[2-[2-(5-methoxy-1-benzofuran-6-yl)ethoxy]ethyl]pyrrolidin-3-yl] oxalate (PubChem CID 66588437) has the molecular formula C36H44N2O10 and a molecular weight of 664.75 g/mol. Its IUPAC name is bis[1-[2-[2-(5-methoxy-1-benzofuran-6-yl)ethoxy]ethyl]pyrrolidin-3-yl] oxalate.
| Compound Name | bis[1-[2-[2-(5-methoxy-1-benzofuran-6-yl)ethoxy]ethyl]pyrrolidin-3-yl] oxalate |
|---|---|
| PubChem CID | 66588437 |
| Molecular Formula | C36H44N2O10 |
| Molecular Weight | 664.75 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | bis[1-[2-[2-(5-methoxy-1-benzofuran-6-yl)ethoxy]ethyl]pyrrolidin-3-yl] oxalate |
| SMILES | COc1cc2ccoc2cc1CCOCCN1CCC(OC(=O)C(=O)OC2CCN(CCOCCc3cc4occc4cc3OC)C2)C1 |
| InChI | InChI=1S/C36H44N2O10/c1-41-31-19-27-7-15-45-33(27)21-25(31)5-13-43-17-11-37-9-3-29(23-37)47-35(39)36(40)48-30-4-10-38(24-30)12-18-44-14-6-26-22-34-28(8-16-46-34)20-32(26)42-2/h7-8,15-16,19-22,29-30H,3-6,9-14,17-18,23-24H2,1-2H3 |
| InChIKey | PANUKZLNWRYGGF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 122.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.75 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|