C12H24N8O2Si2 — CID 157264054
6-amino-1H-1,3,5-triazin-2-one;N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine (PubChem CID 157264054) has the molecular formula C12H24N8O2Si2 and a molecular weight of 368.55 g/mol. Its IUPAC name is 6-amino-1H-1,3,5-triazin-2-one;N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine.
| Compound Name | 6-amino-1H-1,3,5-triazin-2-one;N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 157264054 |
| Molecular Formula | C12H24N8O2Si2 |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 6-amino-1H-1,3,5-triazin-2-one;N-trimethylsilyl-4-trimethylsilyloxy-1,3,5-triazin-2-amine |
| SMILES | C[Si](C)(C)Nc1ncnc(O[Si](C)(C)C)n1.Nc1ncnc(=O)[nH]1 |
| InChI | InChI=1S/C9H20N4OSi2.C3H4N4O/c1-15(2,3)13-8-10-7-11-9(12-8)14-16(4,5)6;4-2-5-1-6-3(8)7-2/h7H,1-6H3,(H,10,11,12,13);1H,(H3,4,5,6,7,8) |
| InChIKey | AXUGPXGUSSKGAZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|