About (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine
(1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine (PubChem CID 157264535) has the molecular formula C13H23N3Pt
and a molecular weight of 416.43 g/mol. Its IUPAC name is (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine.
Molecular Properties
| Compound Name | (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine |
| PubChem CID | 157264535 |
| Molecular Formula | C13H23N3Pt |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine |
| SMILES | Cn1ccn(C2CCCCC2)c1=[Pt].NC1CC1 |
| InChI | InChI=1S/C10H16N2.C3H7N.Pt/c1-11-7-8-12(9-11)10-5-3-2-4-6-10;4-3-1-2-3;/h7-8,10H,2-6H2,1H3;3H,1-2,4H2; |
| InChIKey | AXVQLXLWBPDIQK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine?
The IUPAC name of (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine (CID 157264535) is (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine.
What is the SMILES notation for (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine?
The canonical SMILES for (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine is Cn1ccn(C2CCCCC2)c1=[Pt].NC1CC1.
What is the InChIKey of (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine?
The InChIKey is AXVQLXLWBPDIQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.C3H7N.Pt/c1-11-7-8-12(9-11)10-5-3-2-4-6-10;4-3-1-2-3;/h7-8,10H,2-6H2,1H3;3H,1-2,4H2;.
What are the key properties of (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine?
(1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine has a molecular weight of 416.43 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclohexyl-3-methylimidazol-2-ylidene)platinum;cyclopropanamine is sourced from PubChem (CID 157264535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).